C22H34O2 — CID 11867679
(3R,5S,8R,9S,10S,13R,14R,17R)-3-ethynyl-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11867679) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13R,14R,17R)-3-ethynyl-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3R,5S,8R,9S,10S,13R,14R,17R)-3-ethynyl-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11867679 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (3R,5S,8R,9S,10S,13R,14R,17R)-3-ethynyl-10,13,17-trimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C#C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@H]3[C@H]4CC[C@@](C)(O)[C@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C22H34O2/c1-5-22(24)13-12-19(2)15(14-22)6-7-16-17(19)8-10-20(3)18(16)9-11-21(20,4)23/h1,15-18,23-24H,6-14H2,2-4H3/t15-,16+,17-,18+,19-,20+,21+,22+/m0/s1 |
| InChIKey | DJTOPBVAPKKSCO-PSUOQOADSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|