C23H36O2 — CID 87481953
(8R,9S,10S,13S,14S,17S)-3-ethynyl-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 87481953) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17S)-3-ethynyl-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,10S,13S,14S,17S)-3-ethynyl-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 87481953 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (8R,9S,10S,13S,14S,17S)-3-ethynyl-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C#CC1(O)CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](C(C)O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H36O2/c1-5-23(25)13-12-21(3)16(14-23)6-7-17-19-9-8-18(15(2)24)22(19,4)11-10-20(17)21/h1,15-20,24-25H,6-14H2,2-4H3/t15?,16?,17-,18+,19-,20-,21-,22+,23?/m0/s1 |
| InChIKey | BMSXQUXDIFMOGD-MJGQKJJDSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|