C26H39F3O2 — CID 171642727
(3R,5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-3-prop-1-ynyl-17-[(2S,3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 171642727) has the molecular formula C26H39F3O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-3-prop-1-ynyl-17-[(2S,3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-3-prop-1-ynyl-17-[(2S,3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 171642727 |
| Molecular Formula | C26H39F3O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-3-prop-1-ynyl-17-[(2S,3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)[C@H](O)C(F)(F)F)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H39F3O2/c1-5-11-25(31)14-13-23(3)17(15-25)6-7-18-20-9-8-19(16(2)22(30)26(27,28)29)24(20,4)12-10-21(18)23/h16-22,30-31H,6-10,12-15H2,1-4H3/t16-,17+,18-,19+,20-,21-,22-,23-,24+,25+/m0/s1 |
| InChIKey | QKBUUHVWUGAXPQ-RCAUITAOSA-N |
| XLogP | 5.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|