C21H28ClFO3 — CID 69250370
(3S,4S,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-4-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,16,17-triol (PubChem CID 69250370) has the molecular formula C21H28ClFO3 and a molecular weight of 382.90 g/mol. Its IUPAC name is (3S,4S,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-4-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,16,17-triol.
| Compound Name | (3S,4S,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-4-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,16,17-triol |
|---|---|
| PubChem CID | 69250370 |
| Molecular Formula | C21H28ClFO3 |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (3S,4S,8R,9S,10R,13S,14S,16R,17S)-17-(2-chloroethynyl)-4-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| SMILES | C[C@]12CC[C@H](O)[C@@H](F)C1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1C[C@@H](O)[C@@]2(O)C#CCl |
| InChI | InChI=1S/C21H28ClFO3/c1-19-7-6-16(24)18(23)14(19)4-3-12-13(19)5-8-20(2)15(12)11-17(25)21(20,26)9-10-22/h4,12-13,15-18,24-26H,3,5-8,11H2,1-2H3/t12-,13+,15+,16+,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | BGXHNMOGBCBTKA-RGFFGQIPSA-N |
| XLogP | 3.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|