C23H32O6 — CID 91485067
2-[(8R,9R,10R,13S,14S)-2,7,16,17-tetrahydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate (PubChem CID 91485067) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[(8R,9R,10R,13S,14S)-2,7,16,17-tetrahydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate.
| Compound Name | 2-[(8R,9R,10R,13S,14S)-2,7,16,17-tetrahydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate |
|---|---|
| PubChem CID | 91485067 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[(8R,9R,10R,13S,14S)-2,7,16,17-tetrahydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate |
| SMILES | CC(=O)OC#CC1CC2=CC(O)[C@@H]3[C@@H](CC[C@]4(C)C(O)C(O)C[C@@H]34)[C@@]2(C)CC1O |
| InChI | InChI=1S/C23H32O6/c1-12(24)29-7-5-13-8-14-9-17(25)20-15(23(14,3)11-19(13)27)4-6-22(2)16(20)10-18(26)21(22)28/h9,13,15-21,25-28H,4,6,8,10-11H2,1-3H3/t13?,15-,16+,17?,18?,19?,20-,21?,22+,23+/m1/s1 |
| InChIKey | DQPUUZKERGSYBA-DFNCAVMISA-N |
| XLogP | 1.36 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|