C20H30O4S — CID 58422901
[(1R,4S,7S,9aR,11aR)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3a,3b,4,6,7,8,9,9b,10,11-dodecahydrophenanthro[1,2-b]thiophen-1-yl] acetate (PubChem CID 58422901) has the molecular formula C20H30O4S and a molecular weight of 366.52 g/mol. Its IUPAC name is [(1R,4S,7S,9aR,11aR)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3a,3b,4,6,7,8,9,9b,10,11-dodecahydrophenanthro[1,2-b]thiophen-1-yl] acetate.
| Compound Name | [(1R,4S,7S,9aR,11aR)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3a,3b,4,6,7,8,9,9b,10,11-dodecahydrophenanthro[1,2-b]thiophen-1-yl] acetate |
|---|---|
| PubChem CID | 58422901 |
| Molecular Formula | C20H30O4S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(1R,4S,7S,9aR,11aR)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3a,3b,4,6,7,8,9,9b,10,11-dodecahydrophenanthro[1,2-b]thiophen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CSC2C3C(O)C=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C20H30O4S/c1-11(21)24-16-10-25-18-17-14(5-7-20(16,18)3)19(2)6-4-13(22)8-12(19)9-15(17)23/h9,13-18,22-23H,4-8,10H2,1-3H3/t13-,14?,15?,16-,17?,18?,19-,20+/m0/s1 |
| InChIKey | MTTFDFDKRQWCNU-JTNVJCIVSA-N |
| XLogP | 2.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|