C20H30O6 — CID 59748866
[(2S,5S,9S,14S,15S)-5,9-dihydroxy-15-(hydroxymethyl)-2-methyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-en-14-yl] acetate (PubChem CID 59748866) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is [(2S,5S,9S,14S,15S)-5,9-dihydroxy-15-(hydroxymethyl)-2-methyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-en-14-yl] acetate.
| Compound Name | [(2S,5S,9S,14S,15S)-5,9-dihydroxy-15-(hydroxymethyl)-2-methyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-en-14-yl] acetate |
|---|---|
| PubChem CID | 59748866 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(2S,5S,9S,14S,15S)-5,9-dihydroxy-15-(hydroxymethyl)-2-methyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadec-7-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2C3C(O)C=C4C[C@@H](O)CC[C@]4(C)C3OC[C@@]21CO |
| InChI | InChI=1S/C20H30O6/c1-11(22)26-16-4-3-14-17-15(24)8-12-7-13(23)5-6-19(12,2)18(17)25-10-20(14,16)9-21/h8,13-18,21,23-24H,3-7,9-10H2,1-2H3/t13-,14?,15?,16-,17?,18?,19-,20-/m0/s1 |
| InChIKey | JVWSTBCVDFSLQG-HAFVFWCTSA-N |
| XLogP | 1.17 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|