C21H31BrO5 — CID 158333234
[(3S,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 158333234) has the molecular formula C21H31BrO5 and a molecular weight of 443.38 g/mol. Its IUPAC name is [(3S,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 158333234 |
| Molecular Formula | C21H31BrO5 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [(3S,10R,13S,16R,17R)-16-bromo-3,7-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](Br)CC2C3C(O)C=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21CO |
| InChI | InChI=1S/C21H31BrO5/c1-11(24)27-19-16(22)9-15-18-14(4-6-21(15,19)10-23)20(2)5-3-13(25)7-12(20)8-17(18)26/h8,13-19,23,25-26H,3-7,9-10H2,1-2H3/t13-,14?,15?,16+,17?,18?,19-,20-,21+/m0/s1 |
| InChIKey | CLNQYOGYORQEMB-RXSIEJDDSA-N |
| XLogP | 2.56 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|