C22H33BrO5 — CID 11178583
[(3S,7R,10S,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 11178583) has the molecular formula C22H33BrO5 and a molecular weight of 457.41 g/mol. Its IUPAC name is [(3S,7R,10S,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(3S,7R,10S,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 11178583 |
| Molecular Formula | C22H33BrO5 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(3S,7R,10S,13S,16R,17R)-16-bromo-3,7-dihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](Br)CC2C3C(O)C=C4C[C@@H](O)CC[C@]4(CO)C3CC[C@@]21C |
| InChI | InChI=1S/C22H33BrO5/c1-3-18(27)28-20-16(23)10-15-19-14(5-6-21(15,20)2)22(11-24)7-4-13(25)8-12(22)9-17(19)26/h9,13-17,19-20,24-26H,3-8,10-11H2,1-2H3/t13-,14?,15?,16+,17?,19?,20-,21-,22+/m0/s1 |
| InChIKey | YLJDTCAZPXMUJP-BEKJHCNASA-N |
| XLogP | 2.95 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|