C29H46O4 — CID 163056301
[3,7-dihydroxy-13-methyl-17-(6-methylhept-5-en-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 163056301) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is [3,7-dihydroxy-13-methyl-17-(6-methylhept-5-en-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [3,7-dihydroxy-13-methyl-17-(6-methylhept-5-en-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 163056301 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | [3,7-dihydroxy-13-methyl-17-(6-methylhept-5-en-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | CC(=O)OCC12CCC(O)CC1=CC(O)C1C2CCC2(C)C(C(C)CCC=C(C)C)CCC12 |
| InChI | InChI=1S/C29H46O4/c1-18(2)7-6-8-19(3)23-9-10-24-27-25(12-13-28(23,24)5)29(17-33-20(4)30)14-11-22(31)15-21(29)16-26(27)32/h7,16,19,22-27,31-32H,6,8-15,17H2,1-5H3 |
| InChIKey | PJWWRJFJGMRURW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|