C21H31BO4 — CID 142018343
CID 142018343 (PubChem CID 142018343) has the molecular formula C21H31BO4 and a molecular weight of 358.29 g/mol.
| Compound Name | CID 142018343 |
|---|---|
| PubChem CID | 142018343 |
| Molecular Formula | C21H31BO4 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1CC2C3C(O)C=C4C[C@@H](O)CC[C@@H]4C3CC[C@]2(C)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C21H31BO4/c1-3-18(25)26-20-16(22)10-15-19-14(6-7-21(15,20)2)13-5-4-12(23)8-11(13)9-17(19)24/h9,12-17,19-20,23-24H,3-8,10H2,1-2H3/t12-,13-,14?,15?,16+,17?,19?,20-,21-/m0/s1 |
| InChIKey | SWCFFQLWCFHJEH-ZQWAZMPHSA-N |
| XLogP | 2.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|