C21H34O5 — CID 163762213
[(5S,9S,14R,15S)-5,9-dihydroxy-7,15-dimethyl-12-oxatricyclo[8.7.0.011,15]heptadec-7-en-14-yl] propanoate (PubChem CID 163762213) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is [(5S,9S,14R,15S)-5,9-dihydroxy-7,15-dimethyl-12-oxatricyclo[8.7.0.011,15]heptadec-7-en-14-yl] propanoate.
| Compound Name | [(5S,9S,14R,15S)-5,9-dihydroxy-7,15-dimethyl-12-oxatricyclo[8.7.0.011,15]heptadec-7-en-14-yl] propanoate |
|---|---|
| PubChem CID | 163762213 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [(5S,9S,14R,15S)-5,9-dihydroxy-7,15-dimethyl-12-oxatricyclo[8.7.0.011,15]heptadec-7-en-14-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1COC2C3C(O)C=C(C)C[C@@H](O)CCCC3CC[C@@]21C |
| InChI | InChI=1S/C21H34O5/c1-4-18(24)26-17-12-25-20-19-14(8-9-21(17,20)3)6-5-7-15(22)10-13(2)11-16(19)23/h11,14-17,19-20,22-23H,4-10,12H2,1-3H3/t14?,15-,16?,17-,19?,20?,21+/m0/s1 |
| InChIKey | LZDLHBIYKIXEAN-CGSSNMIRSA-N |
| XLogP | 2.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|