C26H42O6 — CID 59748853
[(2S,5S,9S,14S,15R)-9-hydroxy-2,15-dimethyl-5-pent-1-en-2-ylperoxy-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl] propanoate (PubChem CID 59748853) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is [(2S,5S,9S,14S,15R)-9-hydroxy-2,15-dimethyl-5-pent-1-en-2-ylperoxy-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl] propanoate.
| Compound Name | [(2S,5S,9S,14S,15R)-9-hydroxy-2,15-dimethyl-5-pent-1-en-2-ylperoxy-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl] propanoate |
|---|---|
| PubChem CID | 59748853 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [(2S,5S,9S,14S,15R)-9-hydroxy-2,15-dimethyl-5-pent-1-en-2-ylperoxy-17-oxatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl] propanoate |
| SMILES | C=C(CCC)OO[C@H]1CC[C@@]2(C)C(CC(O)C3C2OC[C@@]2(C)C3CC[C@@H]2OC(=O)CC)C1 |
| InChI | InChI=1S/C26H42O6/c1-6-8-16(3)31-32-18-11-12-25(4)17(13-18)14-20(27)23-19-9-10-21(30-22(28)7-2)26(19,5)15-29-24(23)25/h17-21,23-24,27H,3,6-15H2,1-2,4-5H3/t17?,18-,19?,20?,21-,23?,24?,25-,26-/m0/s1 |
| InChIKey | MOWOZAXOHCFHLG-JLWJGBHCSA-N |
| XLogP | 4.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|