C20H32O5 — CID 59748867
[(1S,4S,7S,9aS,11aS)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromen-1-yl] acetate (PubChem CID 59748867) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is [(1S,4S,7S,9aS,11aS)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromen-1-yl] acetate.
| Compound Name | [(1S,4S,7S,9aS,11aS)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromen-1-yl] acetate |
|---|---|
| PubChem CID | 59748867 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(1S,4S,7S,9aS,11aS)-4,7-dihydroxy-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[4,5-h]isochromen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2C3C(O)CC4C[C@@H](O)OC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C20H32O5/c1-11(21)25-16-5-4-13-18-14(6-7-19(13,16)2)20(3)10-24-17(23)9-12(20)8-15(18)22/h12-18,22-23H,4-10H2,1-3H3/t12?,13?,14?,15?,16-,17-,18?,19-,20-/m0/s1 |
| InChIKey | MOSGBVGNFSZFQE-JSSSAOPLSA-N |
| XLogP | 2.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |