C25H36O7 — CID 69250817
[(8R,9R,10R,13S,14S)-7,17-diacetyloxy-4-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 69250817) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-7,17-diacetyloxy-4-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9R,10R,13S,14S)-7,17-diacetyloxy-4-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 69250817 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-7,17-diacetyloxy-4-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(=CC(OC(C)=O)[C@@H]3[C@H]2CC[C@]2(C)C(OC(C)=O)CC[C@@H]32)C1O |
| InChI | InChI=1S/C25H36O7/c1-13(26)30-19-9-11-24(4)17-8-10-25(5)16(6-7-21(25)32-15(3)28)22(17)20(31-14(2)27)12-18(24)23(19)29/h12,16-17,19-23,29H,6-11H2,1-5H3/t16-,17+,19?,20?,21?,22-,23?,24+,25-/m0/s1 |
| InChIKey | GIEXZEWPSFJGSV-BIKMIQPUSA-N |
| XLogP | 3.33 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|