C23H32O4S — CID 12832212
[(7R,8R,9S,10R,13S,14S,17S)-7-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 12832212) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is [(7R,8R,9S,10R,13S,14S,17S)-7-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,10R,13S,14S,17S)-7-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 12832212 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [(7R,8R,9S,10R,13S,14S,17S)-7-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3[C@H](SC(C)=O)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H32O4S/c1-13(24)27-20-6-5-17-21-18(8-10-23(17,20)4)22(3)9-7-16(26)11-15(22)12-19(21)28-14(2)25/h11,17-21H,5-10,12H2,1-4H3/t17-,18-,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | QZQRFJGIEMKCME-WBIUVFFSSA-N |
| XLogP | 4.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|