C25H36O5 — CID 541199
(3-acetyloxy-4,4,10,13-tetramethyl-7-oxo-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate (PubChem CID 541199) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (3-acetyloxy-4,4,10,13-tetramethyl-7-oxo-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate.
| Compound Name | (3-acetyloxy-4,4,10,13-tetramethyl-7-oxo-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate |
|---|---|
| PubChem CID | 541199 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (3-acetyloxy-4,4,10,13-tetramethyl-7-oxo-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=CC(=O)C3C2CCC2(C)C(OC(C)=O)CCC32)C1(C)C |
| InChI | InChI=1S/C25H36O5/c1-14(26)29-20-10-12-24(5)17-9-11-25(6)16(7-8-21(25)30-15(2)27)22(17)18(28)13-19(24)23(20,3)4/h13,16-17,20-22H,7-12H2,1-6H3 |
| InChIKey | RRAQNKGVKSCOEA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |