C23H34O4 — CID 3892665
(3-acetyloxy-3a,5b,10-trimethyl-1,2,3,4,5,5a,6,7,8,9,10a,10b-dodecahydrocyclopenta[a]fluoren-8-yl) acetate (PubChem CID 3892665) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (3-acetyloxy-3a,5b,10-trimethyl-1,2,3,4,5,5a,6,7,8,9,10a,10b-dodecahydrocyclopenta[a]fluoren-8-yl) acetate.
| Compound Name | (3-acetyloxy-3a,5b,10-trimethyl-1,2,3,4,5,5a,6,7,8,9,10a,10b-dodecahydrocyclopenta[a]fluoren-8-yl) acetate |
|---|---|
| PubChem CID | 3892665 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3-acetyloxy-3a,5b,10-trimethyl-1,2,3,4,5,5a,6,7,8,9,10a,10b-dodecahydrocyclopenta[a]fluoren-8-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=C(C)C3C2CCC2(C)C(OC(C)=O)CCC32)C1 |
| InChI | InChI=1S/C23H34O4/c1-13-19-12-16(26-14(2)24)8-10-22(19,4)18-9-11-23(5)17(21(13)18)6-7-20(23)27-15(3)25/h16-18,20-21H,6-12H2,1-5H3 |
| InChIKey | OBZYXEMSAJPCRP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|