C25H38O4 — CID 86734739
[(1R,3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-1,6,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 86734739) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(1R,3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-1,6,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(1R,3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-1,6,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 86734739 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(1R,3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-1,6,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2=C(C)C[C@H]3[C@@H]4CC[C@H](OC(C)=O)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@H](C)C1 |
| InChI | InChI=1S/C25H38O4/c1-14-11-19-20-7-8-23(29-17(4)27)24(20,5)10-9-21(19)25(6)15(2)12-18(13-22(14)25)28-16(3)26/h15,18-21,23H,7-13H2,1-6H3/t15-,18+,19+,20+,21+,23+,24+,25-/m1/s1 |
| InChIKey | GWESAQKYFYSNIS-WIAVJEEWSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|