C24H34O5 — CID 56984969
[(8R,9R,10R,13S,14S)-7-acetyloxy-1,10,13-trimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 56984969) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-7-acetyloxy-1,10,13-trimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9R,10R,13S,14S)-7-acetyloxy-1,10,13-trimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 56984969 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-7-acetyloxy-1,10,13-trimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1C=C2CC(=O)CC(C)[C@]2(C)[C@@H]2CC[C@]3(C)C(OC(C)=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C24H34O5/c1-13-10-17(27)11-16-12-20(28-14(2)25)22-18-6-7-21(29-15(3)26)23(18,4)9-8-19(22)24(13,16)5/h12-13,18-22H,6-11H2,1-5H3/t13?,18-,19+,20?,21?,22-,23-,24-/m0/s1 |
| InChIKey | BMTUQBPTSNNXCM-IBDUHMGPSA-N |
| XLogP | 4.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|