C26H38O4S2 — CID 99566687
[(2R,3S,8R,9S,10R,13S,14S,17S)-2-acetyloxy-3-(1,3-dithiolan-2-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 99566687) has the molecular formula C26H38O4S2 and a molecular weight of 478.72 g/mol. Its IUPAC name is [(2R,3S,8R,9S,10R,13S,14S,17S)-2-acetyloxy-3-(1,3-dithiolan-2-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(2R,3S,8R,9S,10R,13S,14S,17S)-2-acetyloxy-3-(1,3-dithiolan-2-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 99566687 |
| Molecular Formula | C26H38O4S2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [(2R,3S,8R,9S,10R,13S,14S,17S)-2-acetyloxy-3-(1,3-dithiolan-2-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@H](C5SCCS5)[C@H](OC(C)=O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H38O4S2/c1-15(27)29-22-14-26(4)17(13-19(22)24-31-11-12-32-24)5-6-18-20-7-8-23(30-16(2)28)25(20,3)10-9-21(18)26/h13,18-24H,5-12,14H2,1-4H3/t18-,19-,20-,21-,22+,23-,25-,26-/m0/s1 |
| InChIKey | DFABLELMPQAIGW-JBWDZUSTSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|