C14H24O4 — CID 155761544
[(1S,2S)-2-methoxy-2-methyl-5-(2-methyloxiran-2-yl)cyclohexyl] propanoate (PubChem CID 155761544) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is [(1S,2S)-2-methoxy-2-methyl-5-(2-methyloxiran-2-yl)cyclohexyl] propanoate.
| Compound Name | [(1S,2S)-2-methoxy-2-methyl-5-(2-methyloxiran-2-yl)cyclohexyl] propanoate |
|---|---|
| PubChem CID | 155761544 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | [(1S,2S)-2-methoxy-2-methyl-5-(2-methyloxiran-2-yl)cyclohexyl] propanoate |
| SMILES | CCC(=O)O[C@H]1CC(C2(C)CO2)CC[C@]1(C)OC |
| InChI | InChI=1S/C14H24O4/c1-5-12(15)18-11-8-10(14(3)9-17-14)6-7-13(11,2)16-4/h10-11H,5-9H2,1-4H3/t10?,11-,13-,14?/m0/s1 |
| InChIKey | SAXOLGFNRHQJMD-QGPNDVEFSA-N |
| XLogP | 2.30 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|