C17H30O3 — CID 101195112
[(1R,4S,6R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl] heptanoate (PubChem CID 101195112) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is [(1R,4S,6R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl] heptanoate.
| Compound Name | [(1R,4S,6R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl] heptanoate |
|---|---|
| PubChem CID | 101195112 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | [(1R,4S,6R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)OC2(C)C |
| InChI | InChI=1S/C17H30O3/c1-5-6-7-8-9-15(18)19-14-12-13-10-11-17(14,4)20-16(13,2)3/h13-14H,5-12H2,1-4H3/t13-,14+,17+/m0/s1 |
| InChIKey | AFKLMIQYJRHCNK-JJRVBVJISA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|