C16H28O3 — CID 85312889
(1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl) hexanoate (PubChem CID 85312889) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl) hexanoate.
| Compound Name | (1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl) hexanoate |
|---|---|
| PubChem CID | 85312889 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-yl) hexanoate |
| SMILES | CCCCCC(=O)OC1CC2CCC1(C)OC2(C)C |
| InChI | InChI=1S/C16H28O3/c1-5-6-7-8-14(17)18-13-11-12-9-10-16(13,4)19-15(12,2)3/h12-13H,5-11H2,1-4H3 |
| InChIKey | LSLOEFWHWOYHGN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|