C28H46NO5+ — CID 99992944
[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[4-[2-oxo-2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]morpholin-4-ium-4-yl]acetate (PubChem CID 99992944) has the molecular formula C28H46NO5+ and a molecular weight of 476.68 g/mol. Its IUPAC name is [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[4-[2-oxo-2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]morpholin-4-ium-4-yl]acetate.
| Compound Name | [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[4-[2-oxo-2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]morpholin-4-ium-4-yl]acetate |
|---|---|
| PubChem CID | 99992944 |
| Molecular Formula | C28H46NO5+ |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | [(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-[4-[2-oxo-2-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]morpholin-4-ium-4-yl]acetate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OC(=O)C[N+]1(CC(=O)O[C@H]3C[C@@H]4CC[C@@]3(C)C4(C)C)CCOCC1)C2 |
| InChI | InChI=1S/C28H46NO5/c1-25(2)19-7-9-27(25,5)21(15-19)33-23(30)17-29(11-13-32-14-12-29)18-24(31)34-22-16-20-8-10-28(22,6)26(20,3)4/h19-22H,7-18H2,1-6H3/q+1/t19-,20+,21-,22+,27+,28- |
| InChIKey | ZCAUOVGMFSRWCT-WZBGMGQQSA-N |
| XLogP | 4.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|