About (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate
(1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate (PubChem CID 170691195) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate.
Analyze (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate?
The IUPAC name of (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate (CID 170691195) is (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate.
What is the SMILES notation for (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate?
The canonical SMILES for (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate is CCC(=O)OC1CC2CC(=O)C1(C)C2(C)C.
What is the InChIKey of (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate?
The InChIKey is XOXZUIRNQWHORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-5-11(15)16-10-7-8-6-9(14)13(10,4)12(8,2)3/h8,10H,5-7H2,1-4H3.
What are the key properties of (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate?
(1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate has a molecular weight of 224.30 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7,7-trimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl) propanoate is sourced from PubChem (CID 170691195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).