C21H36O5 — CID 129195565
[2-hydroxy-1-methyl-4-(2-methyloxiran-2-yl)cyclohexyl] 2,2,5-trimethyl-5-(oxiran-2-yl)hexanoate (PubChem CID 129195565) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is [2-hydroxy-1-methyl-4-(2-methyloxiran-2-yl)cyclohexyl] 2,2,5-trimethyl-5-(oxiran-2-yl)hexanoate.
| Compound Name | [2-hydroxy-1-methyl-4-(2-methyloxiran-2-yl)cyclohexyl] 2,2,5-trimethyl-5-(oxiran-2-yl)hexanoate |
|---|---|
| PubChem CID | 129195565 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [2-hydroxy-1-methyl-4-(2-methyloxiran-2-yl)cyclohexyl] 2,2,5-trimethyl-5-(oxiran-2-yl)hexanoate |
| SMILES | CC(C)(CCC(C)(C)C1CO1)C(=O)OC1(C)CCC(C2(C)CO2)CC1O |
| InChI | InChI=1S/C21H36O5/c1-18(2,16-12-24-16)9-10-19(3,4)17(23)26-20(5)8-7-14(11-15(20)22)21(6)13-25-21/h14-16,22H,7-13H2,1-6H3 |
| InChIKey | JIOAQEBUIOXVBP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|