C21H36O3 — CID 145323807
(2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl) 2,2,5,5-tetramethylhept-6-enoate (PubChem CID 145323807) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl) 2,2,5,5-tetramethylhept-6-enoate.
| Compound Name | (2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl) 2,2,5,5-tetramethylhept-6-enoate |
|---|---|
| PubChem CID | 145323807 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl) 2,2,5,5-tetramethylhept-6-enoate |
| SMILES | C=CC(C)(C)CCC(C)(C)C(=O)OC1CC(C(=C)C)CCC1(C)O |
| InChI | InChI=1S/C21H36O3/c1-9-19(4,5)12-13-20(6,7)18(22)24-17-14-16(15(2)3)10-11-21(17,8)23/h9,16-17,23H,1-2,10-14H2,3-8H3 |
| InChIKey | RVGADWOCYNDFRX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|