C21H34O3 — CID 67783302
[(1S)-1-[(2S,4aS,4bR,7R,10S,10aR)-7-hydroxy-1,2,10-trimethyl-3,4,4a,4b,5,6,7,8,10,10a-decahydro-1H-phenanthren-2-yl]ethyl] acetate (PubChem CID 67783302) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is [(1S)-1-[(2S,4aS,4bR,7R,10S,10aR)-7-hydroxy-1,2,10-trimethyl-3,4,4a,4b,5,6,7,8,10,10a-decahydro-1H-phenanthren-2-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(2S,4aS,4bR,7R,10S,10aR)-7-hydroxy-1,2,10-trimethyl-3,4,4a,4b,5,6,7,8,10,10a-decahydro-1H-phenanthren-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 67783302 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | [(1S)-1-[(2S,4aS,4bR,7R,10S,10aR)-7-hydroxy-1,2,10-trimethyl-3,4,4a,4b,5,6,7,8,10,10a-decahydro-1H-phenanthren-2-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@]1(C)CC[C@H]2[C@H](C1C)[C@H](C)C=C1C[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C21H34O3/c1-12-10-16-11-17(23)6-7-18(16)19-8-9-21(5,13(2)20(12)19)14(3)24-15(4)22/h10,12-14,17-20,23H,6-9,11H2,1-5H3/t12-,13?,14+,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | XGEASYDAYZIPHD-CLZHICTKSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|