C22H32O3 — CID 175632206
2-(3-hydroxy-13-methyl-1,2,3,4,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethyl acetate (PubChem CID 175632206) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-(3-hydroxy-13-methyl-1,2,3,4,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethyl acetate.
| Compound Name | 2-(3-hydroxy-13-methyl-1,2,3,4,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethyl acetate |
|---|---|
| PubChem CID | 175632206 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-(3-hydroxy-13-methyl-1,2,3,4,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1CCC2C3=CC=C4CC(O)CCC4C3CCC12C |
| InChI | InChI=1S/C22H32O3/c1-14(23)25-12-10-16-4-8-21-20-6-3-15-13-17(24)5-7-18(15)19(20)9-11-22(16,21)2/h3,6,16-19,21,24H,4-5,7-13H2,1-2H3 |
| InChIKey | JLQYZVMTMSVOCS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |