C27H42O4 — CID 56978940
2-[(8S,9R,10R,13R,14S)-17-(2-acetyloxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethyl acetate (PubChem CID 56978940) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-[(8S,9R,10R,13R,14S)-17-(2-acetyloxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethyl acetate.
| Compound Name | 2-[(8S,9R,10R,13R,14S)-17-(2-acetyloxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 56978940 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 2-[(8S,9R,10R,13R,14S)-17-(2-acetyloxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1CC[C@@]2(C)C(=CC[C@@H]3[C@H]2CC[C@]2(C)C(CCOC(C)=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H42O4/c1-18(28)30-15-11-20-9-13-27(4)22(17-20)5-7-23-24-8-6-21(12-16-31-19(2)29)26(24,3)14-10-25(23)27/h5,20-21,23-25H,6-17H2,1-4H3/t20?,21?,23-,24-,25+,26+,27-/m0/s1 |
| InChIKey | NRQYWADIDJUJHM-BXLDCKRXSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|