C25H41NO2 — CID 143163370
4-[(10R,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylbutanamide (PubChem CID 143163370) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 4-[(10R,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylbutanamide.
| Compound Name | 4-[(10R,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 143163370 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 4-[(10R,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCC[C@H]1CCC2C3CC=C4CC(O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H41NO2/c1-24-15-13-22-20(10-8-18-16-19(27)12-14-25(18,22)2)21(24)11-9-17(24)6-5-7-23(28)26(3)4/h8,17,19-22,27H,5-7,9-16H2,1-4H3/t17-,19?,20?,21?,22?,24+,25-/m0/s1 |
| InChIKey | DGPYYVCRHLDWDC-NXWRUEJBSA-N |
| XLogP | 5.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|