C27H43NO2 — CID 167243791
4-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 167243791) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is 4-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 4-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 167243791 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | 4-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2CCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C27H43NO2/c1-26-15-13-24-22(10-8-20-18-21(29)12-14-27(20,24)2)23(26)11-9-19(26)6-5-7-25(30)28-16-3-4-17-28/h8,19,21-24,29H,3-7,9-18H2,1-2H3/t19-,21-,22-,23-,24-,26+,27-/m0/s1 |
| InChIKey | SGFCTVJPKAELIK-GCDPCEGKSA-N |
| XLogP | 5.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|