C33H56O2S — CID 135639764
pentyl [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate (PubChem CID 135639764) has the molecular formula C33H56O2S and a molecular weight of 516.88 g/mol. Its IUPAC name is pentyl [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate.
| Compound Name | pentyl [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate |
|---|---|
| PubChem CID | 135639764 |
| Molecular Formula | C33H56O2S |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 516.40 |
| IUPAC Name | pentyl [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate |
| SMILES | CCCCCCCCC1CCC2C3CC=C4C[C@@H](SC(=O)OCCCCC)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C33H56O2S/c1-5-7-9-10-11-12-14-25-16-18-29-28-17-15-26-24-27(36-31(34)35-23-13-8-6-2)19-21-33(26,4)30(28)20-22-32(25,29)3/h15,25,27-30H,5-14,16-24H2,1-4H3/t25?,27-,28?,29?,30?,32+,33-/m0/s1 |
| InChIKey | UQHHSSJZGSONDE-BFEDBVIMSA-N |
| XLogP | 10.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|