C34H56O2S — CID 129431350
cyclohexyl [(3R,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate (PubChem CID 129431350) has the molecular formula C34H56O2S and a molecular weight of 528.89 g/mol. Its IUPAC name is cyclohexyl [(3R,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate.
| Compound Name | cyclohexyl [(3R,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate |
|---|---|
| PubChem CID | 129431350 |
| Molecular Formula | C34H56O2S |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | cyclohexyl [(3R,8R,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate |
| SMILES | CCCCCCCC[C@@H]1CC[C@@H]2[C@H]3CC=C4C[C@H](SC(=O)OC5CCCCC5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C34H56O2S/c1-4-5-6-7-8-10-13-25-17-19-30-29-18-16-26-24-28(37-32(35)36-27-14-11-9-12-15-27)20-22-34(26,3)31(29)21-23-33(25,30)2/h16,25,27-31H,4-15,17-24H2,1-3H3/t25-,28-,29-,30-,31-,33-,34+/m1/s1 |
| InChIKey | JOVGVYUYUCQRFW-UFWVRTGDSA-N |
| XLogP | 10.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|