C34H50NO4S- — CID 163151385
[4-[hydroxy(oxido)amino]phenyl] [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate (PubChem CID 163151385) has the molecular formula C34H50NO4S- and a molecular weight of 568.84 g/mol. Its IUPAC name is [4-[hydroxy(oxido)amino]phenyl] [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate.
| Compound Name | [4-[hydroxy(oxido)amino]phenyl] [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate |
|---|---|
| PubChem CID | 163151385 |
| Molecular Formula | C34H50NO4S- |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | [4-[hydroxy(oxido)amino]phenyl] [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanylformate |
| SMILES | CCCCCCCC[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@@H](SC(=O)Oc5ccc(N([O-])O)cc5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C34H50NO4S/c1-4-5-6-7-8-9-10-24-12-18-30-29-17-11-25-23-28(19-21-34(25,3)31(29)20-22-33(24,30)2)40-32(36)39-27-15-13-26(14-16-27)35(37)38/h11,13-16,24,28-31,37H,4-10,12,17-23H2,1-3H3/q-1/t24-,28+,29+,30-,31-,33-,34+/m1/s1 |
| InChIKey | FTFMVMVKKFCSLE-WTYNHILLSA-N |
| XLogP | 10.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|