C32H53ClOS — CID 99568580
S-[(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloro-3-methylbutanethioate (PubChem CID 99568580) has the molecular formula C32H53ClOS and a molecular weight of 521.30 g/mol. Its IUPAC name is S-[(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloro-3-methylbutanethioate.
| Compound Name | S-[(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloro-3-methylbutanethioate |
|---|---|
| PubChem CID | 99568580 |
| Molecular Formula | C32H53ClOS |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | S-[(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloro-3-methylbutanethioate |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](SC(=O)[C@H](Cl)C(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H53ClOS/c1-6-7-8-9-10-11-12-23-14-16-27-26-15-13-24-21-25(35-30(34)29(33)22(2)3)17-19-32(24,5)28(26)18-20-31(23,27)4/h13,22-23,25-29H,6-12,14-21H2,1-5H3/t23-,25-,26-,27-,28-,29+,31+,32-/m0/s1 |
| InChIKey | YHFMMZUOMCRTSB-VNDOOHGZSA-N |
| XLogP | 10.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|