C25H38O4 — CID 138655064
2-[(6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl acetate (PubChem CID 138655064) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-[(6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl acetate.
| Compound Name | 2-[(6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl acetate |
|---|---|
| PubChem CID | 138655064 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 2-[(6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl acetate |
| SMILES | CC[C@H]1C(=O)C2C(CC[C@@]3(C)C2CC[C@@H]3CCOC(C)=O)[C@@]2(C)CCC(=O)CC12 |
| InChI | InChI=1S/C25H38O4/c1-5-18-21-14-17(27)8-11-25(21,4)20-9-12-24(3)16(10-13-29-15(2)26)6-7-19(24)22(20)23(18)28/h16,18-22H,5-14H2,1-4H3/t16-,18-,19?,20?,21?,22?,24-,25-/m1/s1 |
| InChIKey | UGWOBHVLMNRKCW-NVXKENPMSA-N |
| XLogP | 4.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |