C25H42O3 — CID 142450723
ethane;2-(6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)acetic acid (PubChem CID 142450723) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is ethane;2-(6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)acetic acid.
| Compound Name | ethane;2-(6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)acetic acid |
|---|---|
| PubChem CID | 142450723 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | ethane;2-(6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)acetic acid |
| SMILES | CC.CCC1C(=O)C2C3CCC(CC(=O)O)C3(C)CCC2C2(C)CCCCC12 |
| InChI | InChI=1S/C23H36O3.C2H6/c1-4-15-16-7-5-6-11-23(16,3)18-10-12-22(2)14(13-19(24)25)8-9-17(22)20(18)21(15)26;1-2/h14-18,20H,4-13H2,1-3H3,(H,24,25);1-2H3 |
| InChIKey | VFWWTYYIJQUSOV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |