C26H43NaO5S — CID 153281093
sodium [(4R)-4-[(5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentyl] sulfate (PubChem CID 153281093) has the molecular formula C26H43NaO5S and a molecular weight of 490.68 g/mol. Its IUPAC name is sodium [(4R)-4-[(5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentyl] sulfate.
| Compound Name | sodium [(4R)-4-[(5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentyl] sulfate |
|---|---|
| PubChem CID | 153281093 |
| Molecular Formula | C26H43NaO5S |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | sodium [(4R)-4-[(5S,6R,10S,13R,17R)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentyl] sulfate |
| SMILES | CC[C@H]1C(=O)C2C3CC[C@H]([C@H](C)CCCOS(=O)(=O)[O-])[C@@]3(C)CCC2[C@@]2(C)CCCC[C@@H]12.[Na+] |
| InChI | InChI=1S/C26H44O5S.Na/c1-5-18-20-10-6-7-14-25(20,3)22-13-15-26(4)19(11-12-21(26)23(22)24(18)27)17(2)9-8-16-31-32(28,29)30;/h17-23H,5-16H2,1-4H3,(H,28,29,30);/q;+1/p-1/t17-,18-,19-,20+,21?,22?,23?,25+,26-;/m1./s1 |
| InChIKey | VZFAJEKXXBYQKE-SKENYORASA-M |
| XLogP | 2.75 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|