C25H40O3 — CID 145049546
4-[(6R,9S)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid (PubChem CID 145049546) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 4-[(6R,9S)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid.
| Compound Name | 4-[(6R,9S)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid |
|---|---|
| PubChem CID | 145049546 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 4-[(6R,9S)-6-ethyl-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid |
| SMILES | CC[C@H]1C(=O)C2C3CCC(CCCC(=O)O)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C25H40O3/c1-4-17-18-9-5-6-14-25(18,3)20-13-15-24(2)16(8-7-10-21(26)27)11-12-19(24)22(20)23(17)28/h16-20,22H,4-15H2,1-3H3,(H,26,27)/t16?,17-,18?,19?,20+,22?,24?,25?/m1/s1 |
| InChIKey | XSZUIKCPBCBQEB-RXZDSLJGSA-N |
| XLogP | 6.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |