C24H36O4Y-2 — CID 162468537
(5S,6R,10S,13R,17S)-6-ethyl-17-ethyl-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-dione;hydroxymethanone;yttrium (PubChem CID 162468537) has the molecular formula C24H36O4Y-2 and a molecular weight of 477.45 g/mol. Its IUPAC name is (5S,6R,10S,13R,17S)-6-ethyl-17-ethyl-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-dione;hydroxymethanone;yttrium.
| Compound Name | (5S,6R,10S,13R,17S)-6-ethyl-17-ethyl-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-dione;hydroxymethanone;yttrium |
|---|---|
| PubChem CID | 162468537 |
| Molecular Formula | C24H36O4Y-2 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (5S,6R,10S,13R,17S)-6-ethyl-17-ethyl-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-dione;hydroxymethanone;yttrium |
| SMILES | C[CH-][C@H]1CCC2C3C(=O)[C@H](CC)[C@@H]4CC(=O)CC[C@]4(C)C3CC[C@@]21C.O=[C-]O.[Y] |
| InChI | InChI=1S/C23H35O2.CHO2.Y/c1-5-14-7-8-17-20-18(10-12-22(14,17)3)23(4)11-9-15(24)13-19(23)16(6-2)21(20)25;2-1-3;/h5,14,16-20H,6-13H2,1-4H3;(H,2,3);/q2*-1;/t14-,16+,17?,18?,19-,20?,22+,23+;;/m0../s1 |
| InChIKey | JIVRLYWCXDIVTM-APSXTXHLSA-N |
| XLogP | 4.86 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|