C26H40O4Y-2 — CID 162468524
ethoxymethanone;(6S,7S,10R,13R,17S)-6-ethyl-17-ethyl-7-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;yttrium (PubChem CID 162468524) has the molecular formula C26H40O4Y-2 and a molecular weight of 505.51 g/mol. Its IUPAC name is ethoxymethanone;(6S,7S,10R,13R,17S)-6-ethyl-17-ethyl-7-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;yttrium.
| Compound Name | ethoxymethanone;(6S,7S,10R,13R,17S)-6-ethyl-17-ethyl-7-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;yttrium |
|---|---|
| PubChem CID | 162468524 |
| Molecular Formula | C26H40O4Y-2 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | ethoxymethanone;(6S,7S,10R,13R,17S)-6-ethyl-17-ethyl-7-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;yttrium |
| SMILES | CCO[C-]=O.C[CH-][C@H]1CCC2C3C(O)[C@@H](CC)C4=CC(=O)CC[C@]4(C)C3CC[C@@]21C.[Y] |
| InChI | InChI=1S/C23H35O2.C3H5O2.Y/c1-5-14-7-8-17-20-18(10-12-22(14,17)3)23(4)11-9-15(24)13-19(23)16(6-2)21(20)25;1-2-5-3-4;/h5,13-14,16-18,20-21,25H,6-12H2,1-4H3;2H2,1H3;/q2*-1;/t14-,16-,17?,18?,20?,21?,22+,23+;;/m0../s1 |
| InChIKey | IXNHFTMJIBUQJD-JQPXLQOFSA-N |
| XLogP | 5.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|