C23H36O7S2 — CID 88835244
[(6S,7R,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6-methylsulfonyloxy-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate (PubChem CID 88835244) has the molecular formula C23H36O7S2 and a molecular weight of 488.67 g/mol. Its IUPAC name is [(6S,7R,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6-methylsulfonyloxy-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate.
| Compound Name | [(6S,7R,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6-methylsulfonyloxy-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 88835244 |
| Molecular Formula | C23H36O7S2 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [(6S,7R,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6-methylsulfonyloxy-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3[C@@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H36O7S2/c1-6-14-7-8-16-19-17(10-12-22(14,16)2)23(3)11-9-15(24)13-18(23)20(29-31(4,25)26)21(19)30-32(5,27)28/h13-14,16-17,19-21H,6-12H2,1-5H3/t14-,16-,17-,19-,20-,21+,22+,23+/m0/s1 |
| InChIKey | QKGDYIXRBBQJNI-BBFHWCNGSA-N |
| XLogP | 3.45 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|