C22H36O4Y-2 — CID 153399236
(3R,5S,7R,10S,13R,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol;hydroxymethanone;yttrium (PubChem CID 153399236) has the molecular formula C22H36O4Y-2 and a molecular weight of 453.43 g/mol. Its IUPAC name is (3R,5S,7R,10S,13R,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol;hydroxymethanone;yttrium.
| Compound Name | (3R,5S,7R,10S,13R,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol;hydroxymethanone;yttrium |
|---|---|
| PubChem CID | 153399236 |
| Molecular Formula | C22H36O4Y-2 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (3R,5S,7R,10S,13R,17S)-17-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol;hydroxymethanone;yttrium |
| SMILES | C[CH-][C@H]1CCC2C3C(O)C[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C.O=[C-]O.[Y] |
| InChI | InChI=1S/C21H35O2.CHO2.Y/c1-4-13-5-6-16-19-17(8-10-20(13,16)2)21(3)9-7-15(22)11-14(21)12-18(19)23;2-1-3;/h4,13-19,22-23H,5-12H2,1-3H3;(H,2,3);/q2*-1;/t13-,14-,15+,16?,17?,18?,19?,20+,21-;;/m0../s1 |
| InChIKey | AGICIHMGFNQWJU-ZYXCUPKJSA-N |
| XLogP | 3.81 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|