C26H46O2 — CID 59305823
(3R,17R)-10,13-dimethyl-17-(5-methylhexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 59305823) has the molecular formula C26H46O2 and a molecular weight of 390.65 g/mol. Its IUPAC name is (3R,17R)-10,13-dimethyl-17-(5-methylhexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3R,17R)-10,13-dimethyl-17-(5-methylhexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 59305823 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | (3R,17R)-10,13-dimethyl-17-(5-methylhexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | CC(C)CCC(C)[C@H]1CCC2C3C(O)CC4C[C@H](O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C26H46O2/c1-16(2)6-7-17(3)20-8-9-21-24-22(11-13-26(20,21)5)25(4)12-10-19(27)14-18(25)15-23(24)28/h16-24,27-28H,6-15H2,1-5H3/t17?,18?,19-,20-,21?,22?,23?,24?,25?,26?/m1/s1 |
| InChIKey | QKSLQLUCJWYYER-QHVDCNTISA-N |
| XLogP | 6.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |