C24H42O2 — CID 90142459
(10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 90142459) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is (10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 90142459 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | (10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | CCC[C@@H](C)[C@H]1CCC2C3C(O)CC4CC(O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H42O2/c1-5-6-15(2)18-7-8-19-22-20(10-12-24(18,19)4)23(3)11-9-17(25)13-16(23)14-21(22)26/h15-22,25-26H,5-14H2,1-4H3/t15-,16?,17?,18-,19?,20?,21?,22?,23+,24-/m1/s1 |
| InChIKey | KNYUOXNGMJUREJ-GLHQLXPDSA-N |
| XLogP | 5.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |