C25H42O3Os — CID 171063814
carbanide;(4R)-4-[(3R,5S,7S,8R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one;osmium(2+) (PubChem CID 171063814) has the molecular formula C25H42O3Os and a molecular weight of 580.84 g/mol. Its IUPAC name is carbanide;(4R)-4-[(3R,5S,7S,8R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one;osmium(2+).
| Compound Name | carbanide;(4R)-4-[(3R,5S,7S,8R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one;osmium(2+) |
|---|---|
| PubChem CID | 171063814 |
| Molecular Formula | C25H42O3Os |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | carbanide;(4R)-4-[(3R,5S,7S,8R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one;osmium(2+) |
| SMILES | C[C@H](CC[C-]=O)[C@H]1CC[C@H]2[C@H]3C(CC[C@]12C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@@H]3O.[CH3-].[Os+2] |
| InChI | InChI=1S/C24H39O3.CH3.Os/c1-15(5-4-12-25)18-6-7-19-22-20(9-11-24(18,19)3)23(2)10-8-17(26)13-16(23)14-21(22)27;;/h15-22,26-27H,4-11,13-14H2,1-3H3;1H3;/q2*-1;+2/t15-,16+,17-,18-,19+,20?,21+,22+,23+,24-;;/m1../s1 |
| InChIKey | VGAQSEXUSGYZIR-VBAVJYBISA-N |
| XLogP | 4.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|