C19H27NO4 — CID 90942988
(8R,9S,10R,13S,14S)-6-(hydroxyamino)-10,13-dimethyl-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-trione (PubChem CID 90942988) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-6-(hydroxyamino)-10,13-dimethyl-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-trione.
| Compound Name | (8R,9S,10R,13S,14S)-6-(hydroxyamino)-10,13-dimethyl-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-trione |
|---|---|
| PubChem CID | 90942988 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-6-(hydroxyamino)-10,13-dimethyl-1,2,4,5,6,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-trione |
| SMILES | C[C@]12CCC(=O)CC1C(NO)C(=O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H27NO4/c1-18-7-5-10(21)9-13(18)16(20-24)17(23)15-11-3-4-14(22)19(11,2)8-6-12(15)18/h11-13,15-16,20,24H,3-9H2,1-2H3/t11-,12-,13?,15-,16?,18+,19-/m0/s1 |
| InChIKey | DNBXZOFQYHREDP-FERJXAJMSA-N |
| XLogP | 2.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|