C21H31NO3 — CID 86651507
N-[[(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]methyl]formamide (PubChem CID 86651507) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is N-[[(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]methyl]formamide.
| Compound Name | N-[[(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]methyl]formamide |
|---|---|
| PubChem CID | 86651507 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-[[(6S,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]methyl]formamide |
| SMILES | C[C@]12CCC(=O)CC1[C@@H](CNC=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H31NO3/c1-20-7-5-14(24)10-18(20)13(11-22-12-23)9-15-16-3-4-19(25)21(16,2)8-6-17(15)20/h12-13,15-18H,3-11H2,1-2H3,(H,22,23)/t13-,15+,16+,17+,18?,20-,21+/m1/s1 |
| InChIKey | DKXHPIUJMKHLFM-PQNUDUMQSA-N |
| XLogP | 3.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|